CAS 1383968-55-5 is the registry number for 5-Fluoro-2-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1383968-55-5) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: 5-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: XWOXHDQMQIZOAF-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 5-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | XWOXHDQMQIZOAF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)C(=O)O)C |
Computed by PubChem (NCBI)