CAS 2724208-48-2 is the registry number for 3-Fluoro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (CAS 2724208-48-2) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate. InChIKey: AIDDEDUBVQYMGQ-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
| InChIKey | AIDDEDUBVQYMGQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)OC(=O)C |
Computed by PubChem (NCBI)