CAS 1400976-17-1 appears in our catalog under these names: 5-Fluoro-2-(methoxycarbonyl)phenylboronic acid pinacol ester, 98%, 5-Fluoro-2-(methoxycarbonyl)phenylboronic acid pinacol ester, 95-<97%, 5-Fluoro-2-(methoxycarbonyl)phenylboronic acid pinacol ester, ≥97-<99%, Methyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 98%, 5-Fluoro-2-(methoxycarbonyl)phenylboronic acid pinacol ester, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g, 100mg.
Methyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1400976-17-1) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: methyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: RVMVLLXHYRJPOK-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | methyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | RVMVLLXHYRJPOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)C(=O)OC |
Computed by PubChem (NCBI)