CAS 2096332-06-6 is the registry number for 5-Carboxy-2-fluoro-3-methylphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2096332-06-6) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: 4-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: PPXUZUPLUCKDDV-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 4-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | PPXUZUPLUCKDDV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)C)C(=O)O |
Computed by PubChem (NCBI)