cas: 133100-92-2 — see every product listed under this CAS number, including other names
[4-(Benzyloxy)phenyl]methanamine hydrochloride 90% (CAS 133100-92-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A996083-250mg |
| cas | 133100-92-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 709.69 Pln | |
| Ambeed | 25g | 2606.50 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A996083 |
(4-phenylmethoxyphenyl)methanamine;hydrochloride (CAS 133100-92-2) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: (4-phenylmethoxyphenyl)methanamine;hydrochloride. InChIKey: RSZFCDGHJLBYEB-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | (4-phenylmethoxyphenyl)methanamine;hydrochloride |
| InChIKey | RSZFCDGHJLBYEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)