cas: 1373273-46-1 — see every product listed under this CAS number, including other names
{1-[(tert-Butoxy)carbonyl]pyrrolo[3,2-b]pyridin-2-yl}boronic acid, 98%, 98% (CAS 1373273-46-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUXD-100mg |
| cas | 1373273-46-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1360.40 Pln | |
| Chemat | 5g | 4610.00 Pln | |
| Chemat | 10g | 8248.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-2-yl]boronic acid (CAS 1373273-46-1) is a chemical compound with the molecular formula C12H15BN2O4 and a molecular weight of 262.07 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-2-yl]boronic acid. InChIKey: JYPXTBFIVPSJSL-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O4 |
|---|---|
| Molecular weight | 262.07 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-2-yl]boronic acid |
| InChIKey | JYPXTBFIVPSJSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC=N2)(O)O |
Computed by PubChem (NCBI)