cas: 173323-23-4 — see every product listed under this CAS number, including other names
{2-[2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethoxy]ethoxy}acetic acid, 97% (CAS 173323-23-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494421-250MG |
| cas | 173323-23-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1403.69 Pln | |
| Fluorochem | 500mg | 2059.71 Pln | |
| Fluorochem | 1g | 3012.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid (CAS 173323-23-4) is a chemical compound with the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. IUPAC name: 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid. InChIKey: AZIIPBGZTZIKMC-UHFFFAOYSA-N.
| Molecular formula | C10H13NO6 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid |
| InChIKey | AZIIPBGZTZIKMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCC(=O)O |
Computed by PubChem (NCBI)