cas: 173323-23-4 — see every product listed under this CAS number, including other names
Mal-PEG2-CH2COOH 97% (CAS 173323-23-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A219689-100mg |
| cas | 173323-23-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 937.75 Pln | |
| Ambeed | 1g | 2617.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A219689 |
2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid (CAS 173323-23-4) is a chemical compound with the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. IUPAC name: 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid. InChIKey: AZIIPBGZTZIKMC-UHFFFAOYSA-N.
| Molecular formula | C10H13NO6 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid |
| InChIKey | AZIIPBGZTZIKMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCC(=O)O |
Computed by PubChem (NCBI)