CAS 22432-95-7 appears in our catalog under these names: alpha-Decitabine, >95% (HPLC), 4-Amino-1-(2-deoxy-α-D-erythro-pentofuranosyl)-1,3,5-triazin-2(1H)-one, 95%+, 95%+, Decitabine Impurity 38 (α-Decitabine), 1-(2-Deoxy-a-D-ribofuranosyl)-5-azacytosine. Offered by: TRC, Chemat, Chemat Brand, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 250mg, on request, 5mg, 2mg, 25mg.
4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one (CAS 22432-95-7) is a chemical compound with the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. IUPAC name: 4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one. InChIKey: XAUDJQYHKZQPEU-JKUQZMGJSA-N.
| Molecular formula | C8H12N4O4 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 4-amino-1-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| InChIKey | XAUDJQYHKZQPEU-JKUQZMGJSA-N |
| SMILES | C1[C@@H]([C@H](O[C@@H]1N2C=NC(=NC2=O)N)CO)O |
Computed by PubChem (NCBI)