Products 455951-65-2
CAS 455951-65-2 is the registry number for 5-Aza-3’-deoxycytidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one (CAS 455951-65-2) is a chemical compound with the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. IUPAC name: 4-amino-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one. InChIKey: COQIPAMHUKRYHA-KVQBGUIXSA-N.
| Molecular formula | C8H12N4O4 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| InChIKey | COQIPAMHUKRYHA-KVQBGUIXSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=NC(=NC2=O)N)CO |
Computed by PubChem (NCBI)
Synonyms:
5-Aza-3a?deoxycytidine, orb1907418