cas: 1498-88-0 — see every product listed under this CAS number, including other names
1',3',3'-Trimethyl-6-nitrospiro[chromene-2,2'-indoline], 95% (CAS 1498-88-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F054470-10G |
| cas | 1498-88-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 653.95 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 357.18 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (CAS 1498-88-0) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]. InChIKey: PSXPTGAEJZYNFI-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| InChIKey | PSXPTGAEJZYNFI-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C13C=CC4=C(O3)C=CC(=C4)[N+](=O)[O-])C)C |
Computed by PubChem (NCBI)