cas: 1498-88-0 — see every product listed under this CAS number, including other names
1,3,3-Trimethylindolino-6'-nitrobenzopyrylospiran, >98.0%(HPLC)(T) (CAS 1498-88-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0366-1G |
| cas | 1498-88-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 275.70 Pln | |
| TCI | 25g | 2935.93 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (CAS 1498-88-0) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]. InChIKey: PSXPTGAEJZYNFI-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| InChIKey | PSXPTGAEJZYNFI-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C13C=CC4=C(O3)C=CC(=C4)[N+](=O)[O-])C)C |
Computed by PubChem (NCBI)