cas: 1498-88-0 — see every product listed under this CAS number, including other names
1',3',3'-Trimethyl-6-nitrospiro[chromene-2,2'-indoline], 97%, 97% (CAS 1498-88-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DFO-250mg |
| cas | 1498-88-0 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 299.60 Pln | |
| Chemat | 10g | 525.20 Pln | |
| Chemat | 25g | 1077.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (CAS 1498-88-0) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]. InChIKey: PSXPTGAEJZYNFI-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| InChIKey | PSXPTGAEJZYNFI-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C13C=CC4=C(O3)C=CC(=C4)[N+](=O)[O-])C)C |
Computed by PubChem (NCBI)