cas: 62756-24-5 — see every product listed under this CAS number, including other names
1'-Methylspiro[chroman-2,4'-piperidin]-4-one, 97%, 97% (CAS 62756-24-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A3OH-100mg |
| cas | 62756-24-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 500mg | 1202.00 Pln | |
| Chemat | 1g | 1830.80 Pln | |
| Chemat | 5g | 5176.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one (CAS 62756-24-5) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: 1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one. InChIKey: DCENWWFAIVPRAC-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| InChIKey | DCENWWFAIVPRAC-UHFFFAOYSA-N |
| SMILES | CN1CCC2(CC1)CC(=O)C3=CC=CC=C3O2 |
Computed by PubChem (NCBI)