Products 1334367-72-4
CAS 1334367-72-4 appears in our catalog under these names: 2-Benzyl-2-azabicyclo[3.1.1]heptane-1-carboxylic acid, 95%, 2-Benzyl-2-azabicyclo(3.1.1)heptane-1-carboxylic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg.
2-benzyl-2-azabicyclo[3.1.1]heptane-1-carboxylic acid (CAS 1334367-72-4) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: 2-benzyl-2-azabicyclo[3.1.1]heptane-1-carboxylic acid. InChIKey: PXSPEDFYJGUBQE-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2-benzyl-2-azabicyclo[3.1.1]heptane-1-carboxylic acid |
| InChIKey | PXSPEDFYJGUBQE-UHFFFAOYSA-N |
| SMILES | C1CN(C2(CC1C2)C(=O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)