Products 71043-64-6
CAS 71043-64-6 appears in our catalog under these names: 2,2,4-Trimethyl-1,2-dihydroquinolin-6-yl acetate, 95%, 2,2,4-Trimethyl-1,2-dihydroquinolin-6-yl acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2,2,4-trimethyl-1H-quinolin-6-yl) acetate (CAS 71043-64-6) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: (2,2,4-trimethyl-1H-quinolin-6-yl) acetate. InChIKey: PDPJYLYRJOHRGS-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2,2,4-trimethyl-1H-quinolin-6-yl) acetate |
| InChIKey | PDPJYLYRJOHRGS-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)OC(=O)C)(C)C |
Computed by PubChem (NCBI)