CAS 727421-73-0 appears in our catalog under these names: 1-Pentyl-1h-indole-3-carboxylic acid, 90%, 1-Pentyl-1H-indole-3-carboxylic Acid, 1-pentyl-1H-indole-3-carboxylic acid/ 97.25% (existing batch purity), PB–22 3–carboxyindole metabolite. Offered by: Combi-blocks, TRC, TargetMol, GLPBio. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g, 1mg, 5mg, 10mg.
1-pentylindole-3-carboxylic acid (CAS 727421-73-0) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: 1-pentylindole-3-carboxylic acid. InChIKey: HAPJUNILBCTRIJ-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1-pentylindole-3-carboxylic acid |
| InChIKey | HAPJUNILBCTRIJ-UHFFFAOYSA-N |
| SMILES | CCCCCN1C=C(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)