Products 881041-38-9
CAS 881041-38-9 is the registry number for Ethyl 5-isopropyl-1h-indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 5-propan-2-yl-1H-indole-2-carboxylate (CAS 881041-38-9) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: ethyl 5-propan-2-yl-1H-indole-2-carboxylate. InChIKey: XEQITYGXVHXTNP-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | ethyl 5-propan-2-yl-1H-indole-2-carboxylate |
| InChIKey | XEQITYGXVHXTNP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C(C)C |
Computed by PubChem (NCBI)