cas: 3403-70-1 — see every product listed under this CAS number, including other names
1,1'-(9H-Carbazole-3,6-diyl)diethanone, 95%, 95% (CAS 3403-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CKDU-100mg |
| cas | 3403-70-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1355.60 Pln | |
| Chemat | 5g | 5886.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(6-acetyl-9H-carbazol-3-yl)ethanone (CAS 3403-70-1) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 1-(6-acetyl-9H-carbazol-3-yl)ethanone. InChIKey: PQLQXNVTTJCZFJ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 1-(6-acetyl-9H-carbazol-3-yl)ethanone |
| InChIKey | PQLQXNVTTJCZFJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)NC3=C2C=C(C=C3)C(=O)C |
Computed by PubChem (NCBI)