CAS 7498-85-3 appears in our catalog under these names: Ethyl 2–Cyano–3–(1–naphthalenyl)acrylate, Ethyl 2-cyano-3-(1-naphthalenyl)acrylate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Ethyl (E)-2-cyano-3-naphthalen-1-ylprop-2-enoate (CAS 7498-85-3) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: ethyl (E)-2-cyano-3-naphthalen-1-ylprop-2-enoate. InChIKey: LKIMUVKEQPRZFV-GXDHUFHOSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-naphthalen-1-ylprop-2-enoate |
| InChIKey | LKIMUVKEQPRZFV-GXDHUFHOSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC=CC2=CC=CC=C21)/C#N |
Computed by PubChem (NCBI)