CAS 73109-31-6 appears in our catalog under these names: 2-P-Tolyl-4h-isoquinoline-1,3-dione, 95%, 2-(p-Tolyl)isoquinoline-1,3(2H,4H)-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(4-methylphenyl)-4H-isoquinoline-1,3-dione (CAS 73109-31-6) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 2-(4-methylphenyl)-4H-isoquinoline-1,3-dione. InChIKey: NKALWHIBQTXTMK-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-(4-methylphenyl)-4H-isoquinoline-1,3-dione |
| InChIKey | NKALWHIBQTXTMK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)CC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)