Products 106110-70-7
CAS 106110-70-7 appears in our catalog under these names: 2-(3-Methylphenyl)-1,2,3,4-tetrahydroisoquinoline-1,3-dione, 95%, 2-(3-Methylphenyl)-1,2,3,4-tetrahydroisoquinoline-1,3-dione, >95% (HPLC), 2-(m-Tolyl)isoquinoline-1,3(2H,4H)-dione, 97%, 2-(3-Methylphenyl)-1,2,3,4-tetrahydroisoquinoline-1,3-dione. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 500mg, 50mg, 0,5g.
2-(3-methylphenyl)-4H-isoquinoline-1,3-dione (CAS 106110-70-7) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 2-(3-methylphenyl)-4H-isoquinoline-1,3-dione. InChIKey: IOPNLOZONJASQF-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-(3-methylphenyl)-4H-isoquinoline-1,3-dione |
| InChIKey | IOPNLOZONJASQF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)CC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)