CAS 40101-43-7 appears in our catalog under these names: 2-(2,5-Dimethylphenyl)-2,3-dihydro-1h-isoindole-1,3-dione, 95%, 2-(2,5-Dimethylphenyl)isoindoline-1,3-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2,5-dimethylphenyl)isoindole-1,3-dione (CAS 40101-43-7) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)isoindole-1,3-dione. InChIKey: ONMMTSFZNQMAGA-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)isoindole-1,3-dione |
| InChIKey | ONMMTSFZNQMAGA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)