cas: 4165-79-1 — see every product listed under this CAS number, including other names
1,1-Diphenyl-3-buten-1-ol, ≥95%, ≥95% (CAS 4165-79-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EN63-250mg |
| cas | 4165-79-1 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1466.00 Pln | |
| Chemat | 1g | 2939.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1,1-diphenylbut-3-en-1-ol (CAS 4165-79-1) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 1,1-diphenylbut-3-en-1-ol. InChIKey: MCIWONLOVGQSQX-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 1,1-diphenylbut-3-en-1-ol |
| InChIKey | MCIWONLOVGQSQX-UHFFFAOYSA-N |
| SMILES | C=CCC(C1=CC=CC=C1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)