CAS 1514864-84-6 appears in our catalog under these names: 2-Methoxy-9,9-dimethyl-9h-fluorene, 95%, 2–Methoxy–9,9–dimethyl–9H–fluorene, 2-Methoxy-9,9-dimethyl-9H-fluorene, >98.0%(GC), 2-Methoxy-9,9-dimethyl-9H-fluorene, 98%, 98%, 2-Methoxy-9,9-dimethyl-9H-fluorene, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 10g.
2-methoxy-9,9-dimethylfluorene (CAS 1514864-84-6) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 2-methoxy-9,9-dimethylfluorene. InChIKey: ZWBHUKZFZLEKKA-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 2-methoxy-9,9-dimethylfluorene |
| InChIKey | ZWBHUKZFZLEKKA-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)OC)C |
Computed by PubChem (NCBI)