cas: 4163-65-9 — see every product listed under this CAS number, including other names
1,2,3,4,6-Penta-O-acetyl-α-D-mannopyranose, 98%, 98% (CAS 4163-65-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114A84-1g |
| cas | 4163-65-9 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 50g | 189.20 Pln | |
| Chemat | 100g | 304.40 Pln | |
| Chemat | 250g | 659.60 Pln | |
| Chemat | 500g | 1296.00 Pln | |
| Chemat | 1kg | 2157.20 Pln | |
| Chemat | 5kg | 7108.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4S,5S,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate (CAS 4163-65-9) is a chemical compound with the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. IUPAC name: [(2R,3R,4S,5S,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate. InChIKey: LPTITAGPBXDDGR-OWYFMNJBSA-N.
| Molecular formula | C16H22O11 |
|---|---|
| Molecular weight | 390.34 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | LPTITAGPBXDDGR-OWYFMNJBSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)