CAS 3891-59-6 appears in our catalog under these names: (2R,3R,4S,5R)-6-Oxohexane-1,2,3,4,5-pentayl pentaacetate, 95%, (2R,3R,4S,5R)-6-Oxohexane-1,2,3,4,5-pentayl pentaacetate, (2R,3R,4S,5R)–6–Oxohexane–1,2,3,4,5–pentayl pentaacetate, 2,3,4,5,6-Penta-O-acetyl-D-glucose, 97%, 97%, (2R,3R,4S,5R)-6-Oxohexane-1,2,3,4,5-pentayl pentaacetate, 97%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 1kg, 500g, 100g, 5g, 10g, 1000g.
[(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate (CAS 3891-59-6) is a chemical compound with the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. IUPAC name: [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate. InChIKey: UAOKXEHOENRFMP-ZJIFWQFVSA-N.
| Molecular formula | C16H22O11 |
|---|---|
| Molecular weight | 390.34 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate |
| InChIKey | UAOKXEHOENRFMP-ZJIFWQFVSA-N |
| SMILES | CC(=O)OC[C@H]([C@H]([C@@H]([C@H](C=O)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)