CAS 2152-77-4 appears in our catalog under these names: (2S,3R,4S,5R,6S)-6-(acetoxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 98%, Alpha-L-Idopyranose Pentaacetate, α-L-Idopyranose,1,2,3,4,6-pentaacetate. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 1g, 100 mg, 1 g.
[(2S,3R,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate (CAS 2152-77-4) is a chemical compound with the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. IUPAC name: [(2S,3R,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate. InChIKey: LPTITAGPBXDDGR-ZVDSWSACSA-N.
| Molecular formula | C16H22O11 |
|---|---|
| Molecular weight | 390.34 g/mol |
| IUPAC name | [(2S,3R,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | LPTITAGPBXDDGR-ZVDSWSACSA-N |
| SMILES | CC(=O)OC[C@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)