CAS 604-68-2 appears in our catalog under these names: Alpha-D-glucose pentaacetate, 97%, Alpha-D-Glucose Pentaacetate, >95% (GC), (2R,3R,4S,5R,6R)–6–(Acetoxymethyl)tetrahydro–2H–pyran–2,3,4,5–tetrayl tetraacetate, ^a-D-Glucose pentaacetate, 99% , 1,2,3,4,6-Penta-O-acetyl-a-D-glucopyranose. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 5g, 500g, 1kg, 25g, 50g, 250g, 2kg.
[(2R,3R,4S,5R,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate (CAS 604-68-2) is a chemical compound with the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate. InChIKey: LPTITAGPBXDDGR-LJIZCISZSA-N.
| Molecular formula | C16H22O11 |
|---|---|
| Molecular weight | 390.34 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | LPTITAGPBXDDGR-LJIZCISZSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)