CAS 144071-49-8 is the registry number for (3R,4R,5R,6R)-6-(Acetoxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate (CAS 144071-49-8) is a chemical compound with the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate. InChIKey: LPTITAGPBXDDGR-XIHUBIEQSA-N.
| Molecular formula | C16H22O11 |
|---|---|
| Molecular weight | 390.34 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | LPTITAGPBXDDGR-XIHUBIEQSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@H](C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)