cas: 6566-40-1 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydro-4-oxonaphthalene-2-carboxylic acid, 97% (CAS 6566-40-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602032-100MG |
| cas | 6566-40-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 565.44 Pln | |
| Fluorochem | 1g | 1351.63 Pln | |
| Fluorochem | 5g | 4163.14 Pln | |
| Fluorochem | 10g | 7037.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-oxo-2,3-dihydro-1H-naphthalene-2-carboxylic acid (CAS 6566-40-1) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 4-oxo-2,3-dihydro-1H-naphthalene-2-carboxylic acid. InChIKey: UYNMKOITXUEVCZ-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-oxo-2,3-dihydro-1H-naphthalene-2-carboxylic acid |
| InChIKey | UYNMKOITXUEVCZ-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)