CAS 4160-80-9 appears in our catalog under these names: 4-Phenyloxane-2,6-dione, 95%, 4-Phenyldihydro-2H-pyran-2,6(3H)-dione, 97%, 4-Phenyloxane-2,6-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g, 50mg.
4-phenyloxane-2,6-dione (CAS 4160-80-9) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 4-phenyloxane-2,6-dione. InChIKey: DNWAYXNMUKHONN-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-phenyloxane-2,6-dione |
| InChIKey | DNWAYXNMUKHONN-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)OC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)