CAS 1081559-36-5 appears in our catalog under these names: 3-Oxocyclobutyl benzoate, 95%, 3-Oxocyclobutyl benzoate, 97%, 3-Oxocyclobutyl benzoate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 10g, 500mg, 5g.
(3-oxocyclobutyl) benzoate (CAS 1081559-36-5) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: (3-oxocyclobutyl) benzoate. InChIKey: FDNDPGDWTKCCPF-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (3-oxocyclobutyl) benzoate |
| InChIKey | FDNDPGDWTKCCPF-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)