Products 2756181-12-9
CAS 2756181-12-9 is the registry number for 1-(4-Formylphenyl)cyclopropane-1-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-(4-formylphenyl)cyclopropane-1-carboxylic acid (CAS 2756181-12-9) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 1-(4-formylphenyl)cyclopropane-1-carboxylic acid. InChIKey: WPHLNJAASMLHOP-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 1-(4-formylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WPHLNJAASMLHOP-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)C=O)C(=O)O |
Computed by PubChem (NCBI)