CAS 21034-22-0 appears in our catalog under these names: 4-Benzoyldihydro-2(3h)-furanone, 95%, 4-benzoyldihydro-2(3H)-furanone. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g.
4-benzoyloxolan-2-one (CAS 21034-22-0) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 4-benzoyloxolan-2-one. InChIKey: ZNOUXOIZMNTERL-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-benzoyloxolan-2-one |
| InChIKey | ZNOUXOIZMNTERL-UHFFFAOYSA-N |
| SMILES | C1C(COC1=O)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)