cas: 22048-88-0 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydro-quinoline-7-carboxylic acid, 98% (CAS 22048-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F737239-100MG |
| cas | 22048-88-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 250mg | 1627.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,2,3,4-tetrahydroquinoline-7-carboxylic acid (CAS 22048-88-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinoline-7-carboxylic acid. InChIKey: JWFQTXPQWRCFMR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinoline-7-carboxylic acid |
| InChIKey | JWFQTXPQWRCFMR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)C(=O)O)NC1 |
Computed by PubChem (NCBI)