CAS 1071432-99-9 appears in our catalog under these names: 1-Methyl-2,3-dihydro-1h-indole-6-carboxylic acid, 95%, 1-Methylindoline-6-carboxylic acid, 95+%, 1-Methyl-2,3-dihydro-1H-indole-6-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
1-methyl-2,3-dihydroindole-6-carboxylic acid (CAS 1071432-99-9) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1-methyl-2,3-dihydroindole-6-carboxylic acid. InChIKey: LFRPPHGMTHMKPU-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-methyl-2,3-dihydroindole-6-carboxylic acid |
| InChIKey | LFRPPHGMTHMKPU-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)