cas: 933752-32-0 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid, 98.0% (CAS 933752-32-0) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 250 mg, 500 mg, 100 mg, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W045121-1 g |
| cas | 933752-32-0 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1773.26 Pln | |
| MedChemExpress | 250 mg | 765.52 Pln | |
| MedChemExpress | 500 mg | 1150.97 Pln | |
| MedChemExpress | 100 mg | 454.37 Pln | |
| MedChemExpress | 5 g | 4243.87 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid (CAS 933752-32-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid. InChIKey: QEMYLDYQDFRTRT-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid |
| InChIKey | QEMYLDYQDFRTRT-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)