cas: 114527-53-6 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydroquinoline-3-carboxylic acid, 97% (CAS 114527-53-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225086-250MG |
| cas | 114527-53-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2825.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,2,3,4-tetrahydroquinoline-3-carboxylic acid (CAS 114527-53-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinoline-3-carboxylic acid. InChIKey: INRNDFZVAKDYFY-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinoline-3-carboxylic acid |
| InChIKey | INRNDFZVAKDYFY-UHFFFAOYSA-N |
| SMILES | C1C(CNC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)