1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid, 98%
cas: 67123-97-1 — see every product listed under this CAS number, including other names
1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid, 98% (CAS 67123-97-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch11409N-1g |
| cas | 67123-97-1 |
| size | 1g |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 645.20 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 258.82 Pln | |
| BLDpharm | 25g | 297.70 Pln | |
| BLDpharm | 100g | 953.02 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (CAS 67123-97-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid. InChIKey: BWKMGYQJPOAASG-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| InChIKey | BWKMGYQJPOAASG-UHFFFAOYSA-N |
| SMILES | C1C(NCC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid, 3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-, 1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid, Tetrahydro-3-isoquinoline carboxylic acid, H-DL-TIC-OH, rac 1,2,3,4-Tetrahydroisoquinoline-3-carboxylic Acid, 1,2,3,4-Tetrahydro-isoquinoline-3-carboxylic acid, (R)-(+)-1,2,3,4-Tetrahydroisoquinoline-3-Carboxylic Acid, 3-carboxy-1,2,3,4-tetrahydroisoquinoline, Tic-AA