CAS 74163-81-8 appears in our catalog under these names: (3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic Acid, (S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic Acid, >95% (HPLC), L–1,2,3,4–Tetrahydroisoquinoline–3–carboxylic acid, H-L-Tic-OH, (S)-(-)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid, 97. Offered by: Mikromol, TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 4x25mg, 25mg, 100mg, 10g, 25g, 5g, 100g, 1g.
(3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (CAS 74163-81-8) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid. InChIKey: BWKMGYQJPOAASG-VIFPVBQESA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| InChIKey | BWKMGYQJPOAASG-VIFPVBQESA-N |
| SMILES | C1[C@H](NCC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)