cas: 61196-37-0 — see every product listed under this CAS number, including other names
1,2,3,6,7,11b-Hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one, 98%, 98% (CAS 61196-37-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EEP6-100mg |
| cas | 61196-37-0 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1053.20 Pln | |
| Chemat | 5g | 2968.40 Pln | |
| Chemat | 10g | 5853.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one (CAS 61196-37-0) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one. InChIKey: GTRDOUXISKJZGL-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one |
| InChIKey | GTRDOUXISKJZGL-UHFFFAOYSA-N |
| SMILES | C1CN2C(CNCC2=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)