cas: 61196-37-0 — see every product listed under this CAS number, including other names
2,3,6,7-TETRAHYDRO-1H-PYRAZINO[2,1-A]ISOQUINOLIN-4(11BH)-ONE, 98% (CAS 61196-37-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F301384-100MG |
| cas | 61196-37-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 1g | 1388.07 Pln | |
| Fluorochem | 5g | 3402.99 Pln | |
| Fluorochem | 10g | 6417.55 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one (CAS 61196-37-0) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one. InChIKey: GTRDOUXISKJZGL-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one |
| InChIKey | GTRDOUXISKJZGL-UHFFFAOYSA-N |
| SMILES | C1CN2C(CNCC2=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)