cas: 925890-13-7 — see every product listed under this CAS number, including other names
1,2,3-Trifluoro-5-methoxy-4-nitrobenzene 98% (CAS 925890-13-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A221769-1g |
| cas | 925890-13-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 10g | 286.94 Pln | |
| Ambeed | 25g | 592.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A221769 |
1,2,3-trifluoro-5-methoxy-4-nitrobenzene (CAS 925890-13-7) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 1,2,3-trifluoro-5-methoxy-4-nitrobenzene. InChIKey: ZSOYSDLZDZGEFC-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 1,2,3-trifluoro-5-methoxy-4-nitrobenzene |
| InChIKey | ZSOYSDLZDZGEFC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1[N+](=O)[O-])F)F)F |
Computed by PubChem (NCBI)