cas: 23488-38-2 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrabromo-3,6-dimethylbenzene 97% (CAS 23488-38-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A201189-5g |
| cas | 23488-38-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 915.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A201189 |
1,2,4,5-tetrabromo-3,6-dimethylbenzene (CAS 23488-38-2) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. IUPAC name: 1,2,4,5-tetrabromo-3,6-dimethylbenzene. InChIKey: RXKOKVQKECXYOT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 421.75 g/mol |
| IUPAC name | 1,2,4,5-tetrabromo-3,6-dimethylbenzene |
| InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)Br)C)Br)Br |
Computed by PubChem (NCBI)