1,2,4,5-Tetrabromo-3,6-dimethylbenzene, 97%
cas: 23488-38-2 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrabromo-3,6-dimethylbenzene, 97% (CAS 23488-38-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A201189-5g |
| cas | 23488-38-2 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 309.19 Pln | |
| Ambeed | 100g | 921.06 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 197.73 Pln | |
| BLDpharm | 25g | 325.47 Pln | |
| BLDpharm | 100g | 986.34 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 305.12 Pln | |
| Fluorochem | 100g | 945.52 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,2,4,5-tetrabromo-3,6-dimethylbenzene (CAS 23488-38-2) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. IUPAC name: 1,2,4,5-tetrabromo-3,6-dimethylbenzene. InChIKey: RXKOKVQKECXYOT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 421.75 g/mol |
| IUPAC name | 1,2,4,5-tetrabromo-3,6-dimethylbenzene |
| InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)Br)C)Br)Br |
Computed by PubChem (NCBI)