cas: 23488-38-2 — see every product listed under this CAS number, including other names
2,3,5,6-Tetrabromo-p-xylene, >98.0%(GC) (CAS 23488-38-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3202-1G |
| cas | 23488-38-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 123.26 Pln | |
| TCI | 5g | 369.12 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1,2,4,5-tetrabromo-3,6-dimethylbenzene (CAS 23488-38-2) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. IUPAC name: 1,2,4,5-tetrabromo-3,6-dimethylbenzene. InChIKey: RXKOKVQKECXYOT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 421.75 g/mol |
| IUPAC name | 1,2,4,5-tetrabromo-3,6-dimethylbenzene |
| InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)Br)C)Br)Br |
Computed by PubChem (NCBI)