CAS 23488-38-2 appears in our catalog under these names: 2,3,5,6-Tetrabromo-p-xylene, 97%, 2,3,5,6-Tetrabromo-p-xylene, 1,2,4,5–tetrabromo–3,6–dimethylbenzene, 2,3,5,6-Tetrabromo-p-xylene, >98.0%(GC), 1,2,4,5-Tetrabromo-3,6-dimethylbenzene 97%. Offered by: Combi-blocks, Dr. Ehrenstorfer, TRC, GLPBio, TCI. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 50mg, 1mg, 250mg.
1,2,4,5-tetrabromo-3,6-dimethylbenzene (CAS 23488-38-2) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. IUPAC name: 1,2,4,5-tetrabromo-3,6-dimethylbenzene. InChIKey: RXKOKVQKECXYOT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 421.75 g/mol |
| IUPAC name | 1,2,4,5-tetrabromo-3,6-dimethylbenzene |
| InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)Br)C)Br)Br |
Computed by PubChem (NCBI)