cas: 23488-38-2 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrabromo-3,6-dimethylbenzene, 98%, 98% (CAS 23488-38-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NDY-1g |
| cas | 23488-38-2 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 246.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2,4,5-tetrabromo-3,6-dimethylbenzene (CAS 23488-38-2) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. IUPAC name: 1,2,4,5-tetrabromo-3,6-dimethylbenzene. InChIKey: RXKOKVQKECXYOT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 421.75 g/mol |
| IUPAC name | 1,2,4,5-tetrabromo-3,6-dimethylbenzene |
| InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)Br)C)Br)Br |
Computed by PubChem (NCBI)