cas: 1079-17-0 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrachloro-3,6-bis(chloromethyl)benzene 98% (CAS 1079-17-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2280918-250mg |
| cas | 1079-17-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2280918 |
1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene (CAS 1079-17-0) is a chemical compound with the molecular formula C8H4Cl6 and a molecular weight of 312.8 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene. InChIKey: IYGDLOMSJZQSGY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl6 |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene |
| InChIKey | IYGDLOMSJZQSGY-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1Cl)Cl)CCl)Cl)Cl)Cl |
Computed by PubChem (NCBI)